| Identification | |
| Name: | Propanoicacid, 2-bromo-, ethyl ester |
| Synonyms: | Propionicacid, 2-bromo-, ethyl ester (6CI,7CI,8CI);Propionic acid, a-bromo-,ethyl ester (4CI);2-Bromopropionic acid ethyl ester;Ethyl DL-2-bromopropionate;Ethyl a-bromopropanoate;NSC 6753;a-Bromopropionic acid ethyl ester; |
| CAS: | 535-11-5 |
| EINECS: | 208-609-5 |
| Molecular Formula: | C5H9BrO2 |
| Molecular Weight: | 181.03 |
| InChI: | InChI=1/C5H9BrO2/c1-3-8-5(7)4(2)6/h4H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2920 |
| Density: | 1.394 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.445-1.447 |
| Water Solubility: | Immiscible |
| Solubility: | Immiscible |
| Appearance: | Clear, colorless liquid. |
| Specification: |
Propanoicacid, 2-bromo-, ethyl ester , its cas register number is 535-11-5. It also can be called Ethyl alpha-bromopropionate ; 2-Bromopropanoic acid ethyl ester ; Ethyl 2-bromopropanoate ; Ethyl alpha-bromopropanoate ; alpha-Bromopropionic acid ethyl ester ; Propionic acid, 2-bromo-, ethyl ester (6CI,7CI,8CI) .It is a clear colorless to very slightly yellow liquid. |
| Packinggroup: | III |
| HS Code: | 29159080 |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
