| Identification | |
| Name: | Benzeneacetic acid, a-methylene-, (1a,2b,4b,5a,7b)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-ylester |
| Synonyms: | 1aH,5aH-Tropan-3a-ol, 6b,7b-epoxy-, atropate (ester) (8CI); Aposcopolamine(6CI,7CI); Benzeneacetic acid, a-methylene-, 9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl ester, (1a,2b,4b,5a,7b)-; 3-Oxa-9-azatricyclo[3.3.1.02,4]nonane,benzeneacetic acid deriv.; Apohyoscine; Aposcopolamin |
| CAS: | 535-26-2 |
| Molecular Formula: | C17H19 N O3 |
| Molecular Weight: | 285.34 |
| InChI: | InChI=1/C17H19NO3/c1-10(11-6-4-3-5-7-11)17(19)20-12-8-13-15-16(21-15)14(9-12)18(13)2/h3-7,12-16H,1,8-9H2,2H3/t12?,13-,14+,15-,16+ |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 95-98°C |
| Flash Point: | 205.1°C |
| Boiling Point: | 415.5°Cat760mmHg |
| Density: | 1.25g/cm3 |
| Refractive index: | 1.604 |
| Specification: | White Solid usageEng:A metabolite of Scopolamine |
| Flash Point: | 205.1°C |
| Usage: | A metabolite of Scopolamine |
| Safety Data | |
 |
|
