| Identification | |
| Name: | 4-Hydroxycinnoline-3-carboxylic acid |
| Synonyms: | 4-Oxo-1H-cinnoline-3-carboxylic acid |
| CAS: | 53512-17-7 |
| Molecular Formula: | C9H6N2O3 |
| Molecular Weight: | 190.16 |
| InChI: | InChI=1/C9H6N2O3/c12-8-5-3-1-2-4-6(5)10-11-7(8)9(13)14/h1-4H,(H,10,12)(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 212.4°C |
| Boiling Point: | 427.6°C at 760 mmHg |
| Density: | 1.56g/cm3 |
| Refractive index: | 1.71 |
| Specification: |
The 4-Hydroxycinnoline-3-carboxylic acid with the cas number 53512-17-7, is also called 4-oxo-1H-cinnoline-3-carboxylic acid . The properties of this chemical are: (1)#H bond acceptors: 5 ; (2)#H bond donors: 2 ; (3)#Freely Rotating Bonds: 1 ; (4)Polar Surface Area: 58.97Å2 ; (5)Index of Refraction: 1.71 ; (6)Molar Refractivity: 47.58 cm3 ; (7)Molar Volume: 121.7 cm3 ; (8)Polarizability: 18.86×10-24cm3 ; (9)Surface Tension: 67.4 dyne/cm ; (10)Enthalpy of Vaporization: 71.96 kJ/mol ; (11)Vapour Pressure: 4.5×10-8 mmHg at 25°C. This chemical can be supplied by Jinan autumn pharmaceutical technology CO., Ltd. |
| Flash Point: | 212.4°C |
| Safety Data | |
 |
|
