| Identification | |
| Name: | 6-methylheptyl (4-chloro-2-methylphenoxy)acetate - butyl 9-hydroxy-9H-fluorene-9-carboxylate (1:1) |
| Synonyms: | 53568-85-7;ANITEN;AC1L24IY;butyl 9-hydroxyfluorene-9-carboxylate; 6-methylheptyl 2-(4-chloro-2-methylphenoxy)acetate;6-methylheptyl (4-chloro-2-methylphenoxy)acetate - butyl 9-hydroxy-9H-fluorene-9-carboxylate (1:1);9H-Fluorene-9-carboxylic acid, 9-hydroxy-, butyl ester, mixt. with isooctyl (4-chloro-2-methylphenoxy)acetate;Butyl 9-hydroxy-9H-fluorene-9-carboxylate mixt. with isooctyl (4-chloro-2-methylphenoxy)acetate |
| CAS: | 53568-85-7 |
| Molecular Formula: | C35H43ClO6 |
| Molecular Weight: | 595.1653 |
| InChI: | InChI=1/C18H18O3.C17H25ClO3/c1-2-3-12-21-17(19)18(20)15-10-6-4-8-13(15)14-9-5-7-11-16(14)18;1-13(2)7-5-4-6-10-20-17(19)12-21-16-9-8-15(18)11-14(16)3/h4-11,20H,2-3,12H2,1H3;8-9,11,13H,4-7,10,12H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 131.1°C |
| Boiling Point: | 387.3°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 131.1°C |
| Safety Data | |
 |
|
