| Identification | |
| Name: | L-Tyrosine benzyl ester p-toluenesulfonate |
| CAS: | 53587-11-4 |
| EINECS: | 258-650-8 |
| Molecular Formula: | C16H17NO3.C7H8O3S |
| Molecular Weight: | 443.51 g/mol |
| InChI: | InChI=1/C16H17NO3.C7H8O3S/c17-15(10-12-6-8-14(18)9-7-12)16(19)20-11-13-4-2-1-3-5-13;1-6-2-4-7(5-3-6)11(8,9)10/h1-9,15,18H,10-11,17H2;2-5H,1H3,(H,8,9,10)/t15-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 177 - 180 ºC |
| Flash Point: | 359.8 ºC |
| Boiling Point: | 438.7 ºC at 760 mmHg |
| Refractive index: | -13 ° (C=3, MeOH) |
| Appearance: | White to off-white crystalline powder |
| Specification: |
L-Tyrosine benzyl ester p-toluenesulfonate, its cas register number is 53587-11-4. It also can be called O-benzyl-L-tyrosine toluene-p-sulphonate . |
| Flash Point: | 359.8 ºC |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
