| Identification | |
| Name: | Benzoic acid,2-bromo-3-methyl- |
| Synonyms: | m-Toluicacid, 2-bromo- (6CI); 2-Bromo-3-methylbenzoic acid; 2-Bromo-m-toluic acid |
| CAS: | 53663-39-1 |
| Molecular Formula: | C8H7 Br O2 |
| Molecular Weight: | 215.05 |
| InChI: | InChI=1/C8H7BrO2/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4H,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 140.2°C |
| Boiling Point: | 308.3°Cat760mmHg |
| Density: | 1.599g/cm3 |
| Refractive index: | 1.595 |
| Specification: | Off-white powder Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Flash Point: | 140.2°C |
| Safety Data | |
 |
|
