| Identification | |
| Name: | Phenol,4-[(1E)-2-(3,5-dimethoxyphenyl)ethenyl]- |
| Synonyms: | 4-Stilbenol,3',5'-dimethoxy-, (E)- (8CI);Phenol, 4-[2-(3,5-dimethoxyphenyl)ethenyl]-,(E)-;(E)-2-(3,5-Dimethoxyphenyl)-1-(4-hydroxyphenyl)ethene;(E)-4-Hydroxy-3',5'-dimethoxystilbene;3,5-Dimethoxy-4'-hydroxy-trans-stilbene;trans-3,5-Dimethoxy-4'-hydroxystilbene; |
| CAS: | 537-42-8 |
| Molecular Formula: | C16H16O3 |
| Molecular Weight: | 256.29644 |
| InChI: | InChI=1S/C16H16O3/c1-18-15-9-13(10-16(11-15)19-2)4-3-12-5-7-14(17)8-6-12/h3-11,17H,1-2H3/b4-3+ |
| Molecular Structure: | ![(C16H16O3) 4-Stilbenol,3',5'-dimethoxy-, (E)- (8CI);Phenol, 4-[2-(3,5-dimethoxyphenyl)ethenyl]-,(E)-;(E)-2-(3,5...](https://img.guidechem.com/casimg/537-42-8.gif) |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.169 g/cm3 |
| Water Solubility: | Insoluble (DMSO: 20 mg/ml) |
| Solubility: | Insoluble (DMSO: 20 mg/ml) |
| Appearance: | off-white crystalline powder |
| Specification: |
?Pterostilbene (CAS NO.537-42-8) is a stilbenoid chemically related to resveratrol. It is the key compound found predominantly in blueberries (as well as grapes),which has anti-cancer, anti-hypercholesterolemia, anti-hypertriglyceridemia properties, as well as fight off and reverse cognitive decline. It is also has anti-diabetic effect, but so far ,this issue little has been studied on .Moreover?it is also?used as a potent anti-fungal. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
