| Identification | |
| Name: | 2-Propenoic acid,3-(3-hydroxy-4-methoxyphenyl)- |
| Synonyms: | Cinnamicacid, 3-hydroxy-4-methoxy- (7CI,8CI);3-Hydroxy-4-methoxycinnamic acid;4-Methoxycaffeic acid;4-O-Methylcaffeic acid;Hesperetic acid;Isoferulicacid;NSC 51987; |
| CAS: | 537-73-5 |
| EINECS: | 208-676-0 |
| Molecular Formula: | C10H10O4 |
| Molecular Weight: | 194.19 |
| InChI: | InChI=1/C10H10O4/c1-14-9-4-2-7(6-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3- |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.316 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | White to tan crystals |
| Specification: |
Isoferulic acid , its cas register number is 537-73-5. It also can be called 2-Propenoic acid,3-(3-hydroxy-4-methoxyphenyl)- ; Cinnamic acid, 3-hydroxy-4-methoxy- ; Hesperetic acid ; 3-(3-Hydroxy-4-methoxyphenyl)-2-propenoic acid ; 3-Hydroxy-4-methoxycinnamic acid ; Cinnamic acid, 3-hydroxy-4-methoxy- (8CI) .It is a off-white crystalline solid. |
| HS Code: | 29189090 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. No special precautions indicated. |
| Usage: | Hypoglycemic |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
