| Identification | |
| Name: | N-(4-aminophenyl)benzene-1,4-diamine |
| Synonyms: | N-(4-Aminophenyl)benzene-1,4-diamine sulphate (1:1);N-(4-aminophenyl)benzene-1,4-diamine; sulfuric acid;4,4'-Diaminodiphenylamine sulphate;4-4' IMINODIANILINE; |
| CAS: | 53760-27-3 |
| EINECS: | 228-864-6 |
| Molecular Formula: | C12H15N3O4S |
| Molecular Weight: | 297.32 |
| InChI: | InChI=1/C12H13N3.H2O4S/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;1-5(2,3)4/h1-8,15H,13-14H2;(H2,1,2,3,4)/p-2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Melting Point: | 300 |
| Appearance: | dark blue very fine crystalline powder |
| Specification: | DARK BLUE VERY FINE CRYSTALLINE POWDER usageEng:A compound used in anti-corrosive coating material for the prevention of corrosion in metals. |
| Storage Temperature: | Refrigerator |
| Usage: | A compound used in anti-corrosive coating material for the prevention of corrosion in metals. |
| Safety Data | |
 |
|
