| Identification | |
| Name: | Propanoic acid,3-bromo-, ethyl ester |
| Synonyms: | Propionicacid, 3-bromo-, ethyl ester (6CI,7CI,8CI);2-Ethoxycarbonylethyl bromide;3-Bromopropanoic acid ethyl ester;3-Bromopropionic acid ethyl ester;Ethyl3-bromopropanoate;Ethyl 3-bromopropionate;Ethyl b-bromopropionate;NSC 21812;b-Bromopropionic acid ethyl ester; |
| CAS: | 539-74-2 |
| EINECS: | 208-724-0 |
| Molecular Formula: | C5H9BrO2 |
| Molecular Weight: | 181.03 |
| InChI: | InChI=1/C5H9BrO2/c1-2-8-5(7)3-4-6/h2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.412 |
| Refractive index: | 1.451-1.453 |
| Appearance: | Colorless transparent liquid |
| Specification: |
Propanoic acid,3-bromo-, ethyl ester , its cas register number is 539-74-2. It also can be called Ethyl 3-bromopropanoate ; Ethyl 3-bromopropionate ; Ethyl beta-bromopropionate .It is a clear colorless to pale yellow liquid. |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
