| Identification | |
| Name: | 4-Thiazolecarboxylicacid, 2-amino-, ethyl ester |
| Synonyms: | 2-Amino-1,3-thiazole-4-carboxylicacid ethyl ester;2-Amino-4-(ethoxycarbonyl)-1,3-thiazole;2-Amino-4-ethoxycarbonylthiazole;2-Amino-4-thiazolecarboxylic acid ethylester;2-Aminothiazol-4-carboxylic acid ethyl ester;Ethyl 2-amino-4-thiazolecarboxylate;NSC43547;NSC 4464;2-Amino-thiazole-4-carboxylic acid ethyl ester;ethyl 2-amino-1,3-thiazole-4-carboxylate; |
| CAS: | 5398-36-7 |
| Molecular Formula: | C6H8N2O2S |
| Molecular Weight: | 172.21 |
| InChI: | InChI=1/C6H8N2O2S/c1-2-10-5(9)4-3-11-6(7)8-4/h3H,2H2,1H3,(H2,7,8) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 140.1 oC |
| Boiling Point: | 308oCat 760 mmHg |
| Density: | 1.336 g/cm3 |
| Refractive index: | 1.588 |
| Appearance: | Light yellow crystal |
| Specification: |
??4-Thiazolecarboxylic acid, 2-amino-, ethyl ester , with CAS number of 5398-36-7, can be called 2-Aminothiazole-4-ethylformate ; Ethyl 2-amino-1,3-thiazole-4-carboxylate ; Ethyl 2-aminothiazole-4-carboxylate . It is a?white crystal powde. |
| Flash Point: | 140.1 oC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
Xn: Harmful
|
 |
|
