| Identification |
| Name: | Sodium nicotinate |
| Synonyms: | - |
| CAS: | 54-86-4 |
| EINECS: | 200-215-1 |
| Molecular Formula: | C6H4NNaO2 |
| Molecular Weight: | 145.09 |
| InChI: | InChI=1/C6H5NO2.Na/c8-6(9)5-2-1-3-7-4-5;/h1-4H,(H,8,9);/q;+1/p-1 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 236.6 deg C |
| Flash Point: | 130.7°C |
| Boiling Point: | 292.5°Cat760mmHg |
| Density: | 1.293g/cm3 |
| Solubility: | Slightly soluble in ethanol and ethyl ether Soluble in alcohol, insoluble in most lipid solvents In water, 18,000 mg/L at 20 deg C |
| Specification: |
Nicotinic Acid, Sodium Salt (CAS NO.54-86-4) is a cristalline powder.
|
| Report: |
Reported in EPA TSCA Inventory.
|
| Flash Point: | 130.7°C |
| Color: | Needles from alc or water Colorless needles |
| Usage: |
Nicotinic Acid, Sodium Salt (CAS NO.54-86-4) is an intermediate for the cosmetic and the pharmaceutical industry.
|
| Safety Data |
| |
 |