| Identification | |
| Name: | Propanoic acid,2-methylpropyl ester |
| Synonyms: | Propionicacid, isobutyl ester (6CI,7CI,8CI);2-Methylpropyl propanoate;2-Methylpropylpropionate;Isobutyl propanoate;Isobutyl propionate;NSC 8450; |
| CAS: | 540-42-1 |
| EINECS: | 208-746-0 |
| Molecular Formula: | C7H14O2 |
| Molecular Weight: | 130.19 |
| InChI: | InChI=1/C7H14O2/c1-4-7(8)9-5-6(2)3/h6H,4-5H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2394 3/PG 3 |
| Density: | 0.86 |
| Refractive index: | 1.396-1.398 |
| Water Solubility: | Insoluble in water |
| Solubility: | Insoluble in water |
| Appearance: | colorless to light yellow liquid. |
| Specification: | clear colorless liquid Safety Statements:16 16:Keep away from sources of ignition - No smoking |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
 |
|
