| Identification |
| Name: | 5-Nitroindazole |
| Synonyms: | 5-Nitro-1H-indazole; 5-Nitroindazoles |
| CAS: | 5401-94-5 |
| EINECS: | 226-451-5 |
| Molecular Formula: | C7H5N3O2 |
| Molecular Weight: | 163.13 |
| InChI: | InChI=1/C7H5N3O2/c11-10(12)6-1-2-7-5(3-6)4-8-9-7/h1-4H,(H,8,9) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs
|
| Density: | 1.525 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.74 |
| Solubility: | Insoluble |
| Appearance: | yellow to green
crystals |
| HS Code: | 29339990 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
