| Identification | |
| Name: | Butane,1-iodo-3-methyl- |
| Synonyms: | 1-Iodo-3-methylbutane;3-Methyl-1-iodobutane;3-Methylbutyliodide;4-Iodo-2-methylbutane;Iso-Amyliodide;Isoamyl iodide;Isopentyl iodide; |
| CAS: | 541-28-6 |
| EINECS: | 208-773-8 |
| Molecular Formula: | C5H11I |
| Molecular Weight: | 198.05 |
| InChI: | InChI=1/C5H11I/c1-5(2)3-4-6/h5H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.497 |
| Refractive index: | 1.492 |
| Appearance: | clear slightly yellow to pink liquid |
| Specification: |
Isoamyl iodide (541-28-6),which also can be called for Isopentyl iodide ; Isoamyl iodide ; Iodo-isopentane ; 1-iodo-3-methylbutane ; 1-iodo-3-methyl-butan ; 1-Jod-3-methylbutan ; 3-Methyl-1-iodobutane ; 3-Methylbutyliodide . Isoamyl iodide (541-28-6) is clear slightly yellow to pink liquid and it's insoluble in water.It's vapors may cause dizziness or suffocation.It's may cause irritation or burns. Isoamyl iodide (541-28-6) decomposed into iodide poisonous vapor when heated and it decomposed into aggressive gas with water.Take care of this is a poisonous chemical.When heated to decomposition it emits toxic vapors of I− . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29033080 |
| Storage Temperature: | Flammables area |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
