| Identification | |
| Name: | Thiazole, 2,4-dimethyl- |
| Synonyms: | 2,4-Dimethyl-1,3-thiazole;2,4-Methylthiazole;NSC 7510; |
| CAS: | 541-58-2 |
| EINECS: | 208-786-9 |
| Molecular Formula: | C5H7NS |
| Molecular Weight: | 113.18 |
| InChI: | InChI=1/C5H7NS/c1-4-3-7-5(2)6-4/h3H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 3/PG 3 |
| Density: | 1.05 |
| Refractive index: | 1.5081-1.5101 |
| Appearance: | Colorless to light yellow liquid |
| Specification: | Colorless to light yellow liqui Safety Statements:16-26-36-37/39 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Storage Temperature: | −20°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
