| Identification | |
| Name: | Acetic acid, 2-chloro-,1,1'-anhydride |
| Synonyms: | Aceticacid, chloro-, anhydride (6CI,7CI,8CI,9CI);2-Chloroacetic anhydride;Chloracetic anhydride;Chloroacetic acid anhydride;Chloroacetic anhydride;Chloroacetyl anhydride;NSC 71207;a,a'-Dichloroacetic anhydride; |
| CAS: | 541-88-8 |
| EINECS: | 208-794-2 |
| Molecular Formula: | C4H4Cl2O3 |
| Molecular Weight: | 170.97 |
| InChI: | InChI=1/C4H4Cl2O3/c5-1-3(7)9-4(8)2-6/h1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Density: | 1.54 |
| Refractive index: | 1.456 |
| Solubility: | Freely sol in ether, chloroform; slightly sol in benzene; practically insol in cold petroleum ether |
| Appearance: | brownish semi-transparent crystals |
| Specification: |
Chloracetic anhydride , its CAS NO. is 541-88-8, the synonyms are 2-Chloroacetic anhydride ; AI3-52321 ; Acetic acid, chloro-, anhydride ; Chloroacetic acid anhydride ; Chloroacetic anhydride ; Chloroethanoic anhydride ; EINECS 208-794-2 ; HSDB 5685 ; Monochloroacetic acid anhydride ; NSC 71207 ; Sym-dichloroacetic anhydride ; alpha,alpha'-Dichloroacetic anhydride . |
| Packinggroup: | II |
| Sensitive: | Moisture Sensitive |
| Color: | PRISMS FROM BENZENE Colorless to slightly yellow crystals |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
