| Identification | |
| Name: | Arsonous dichloride,As-(4-aminophenyl)-, hydrochloride (1:1) |
| Synonyms: | Arsonousdichloride, (4-aminophenyl)-, monohydrochloride (9CI) |
| CAS: | 5410-78-6 |
| Molecular Formula: | C6H6 As Cl2 N . Cl H |
| Molecular Weight: | 274.41 |
| InChI: | InChI=1/C6H6AsCl2N/c8-7(9)5-1-3-6(10)4-2-5/h1-4H,10H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 153.3°C |
| Boiling Point: | 329.8°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
4-Aminophenyldichloroarsine , its CAS NO. is 5410-78-6, the synonyms are 4-Anilinodichloroarsine, hydrochloride ; Aniline, p-(dichloroarsino)-, hydrochloride ; Arsine, (p-aminophenyl)dichloro-, hydrochloride ; NSC 12683 ; p-Dichloroarsinoaniline hydrochloride ; Aniline, p-dichloroarsino-, hydrochloride ; Arsonous dichloride, (4-aminophenyl)-, monohydrochloride (9CI) . |
| Flash Point: | 153.3°C |
| Usage: | A useful reagent for the study of 2-oxoacid dehydrogenase multienzyme complexes. |
| Safety Data | |
 |
|
