| Identification | |
| Name: | Benzenemethanamine,N-butyl-a-methyl- |
| Synonyms: | Benzylamine,N-butyl-a-methyl- (7CI,8CI);(RS)-N-(1-Phenylethyl)butan-1-amine; Butyl(1-phenylethyl)amine; N-Butyl-a-methylbenzylamine; NSC 6273 |
| CAS: | 5412-64-6 |
| EINECS: | 226-495-5 |
| Molecular Formula: | C12H19 N |
| Molecular Weight: | 177.32 |
| InChI: | InChI=1/C12H19N/c1-3-4-10-13-11(2)12-8-6-5-7-9-12/h5-9,11,13H,3-4,10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 91.2°C |
| Boiling Point: | 240.8°Cat760mmHg |
| Density: | 0.896g/cm3 |
| Refractive index: | 1.497 |
| Specification: |
N-butyl-a-methylbenzylamine with CAS number of 5412-64-6 is also named as 4-12-00-02427 (Beilstein Handbook Reference) ; BRN 2088270 ; EINECS 226-495-5 ; N-Butyl-alpha-methylbenzylamine ; NSC 6273 . |
| Flash Point: | 91.2°C |
| Safety Data | |
 |
|
