| Identification | |
| Name: | 1H-Indol-3-ol, sodiumsalt (1:1) |
| Synonyms: | 1H-Indol-3-ol,monosodium salt (9CI); Indol-3-ol, monosodium salt (8CI) |
| CAS: | 5415-19-0 |
| Molecular Formula: | C8H7 N O . Na |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C8H7NO.Na/c10-8-5-9-7-4-2-1-3-6(7)8;/h1-5,9-10H;/q;+1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 161.4°C |
| Boiling Point: | 343.2°Cat760mmHg |
| Density: | 1.327g/cm3 |
| Specification: |
The extinguishing agent of 1H-Indol-3-ol (CAS No.5415-19-0) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 161.4°C |
| Safety Data | |
 |
|
