| Identification | |
| Name: | Pentanenitrile,4-methyl- |
| Synonyms: | Valeronitrile,4-methyl- (6CI,7CI,8CI); 4-Methylpentanenitrile; 4-Methylpentanonitrile;4-Methylvaleronitrile; Isoamyl cyanide; Isocapronitrile; Isohexanonitrile;Isopentyl cyanide; NSC 6109 |
| CAS: | 542-54-1 |
| EINECS: | 208-817-6 |
| Molecular Formula: | C6H11 N |
| Molecular Weight: | 97.18 |
| InChI: | InChI=1/C6H11N/c1-6(2)4-3-5-7/h6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1992 |
| Flash Point: | 45.6°C |
| Boiling Point: | 154°Cat760mmHg |
| Density: | 0.8g/cm3 |
| Refractive index: | 1.404 |
| Specification: | Safety Statements:16-26-36/37/39 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 45.6°C |
| Safety Data | |
 |
|
