| Identification | |
| Name: | Acetic acid,2-mercapto-, ammonium salt (1:1) |
| Synonyms: | Aceticacid, mercapto-, monoammonium salt (8CI,9CI);Ammonium mercaptoacetate;Ammonium thioglycolate;Ammonium thioglycollate;Thiofaco A-50;Thioglycolicacid ammonium salt; |
| CAS: | 5421-46-5 |
| EINECS: | 226-540-9 |
| Molecular Formula: | C2H7NO2S |
| Molecular Weight: | 109.14 |
| InChI: | InChI=1/C2H4O2S.H3N/c3-2(4)1-5;/h5H,1H2,(H,3,4);1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 240kgs |
| Melting Point: | -10 C |
| Boiling Point: | 115 C |
| Density: | 1.311g/cm3 |
| Stability: | No data. |
| Water Solubility: | Miscible |
| Solubility: | Miscible |
| Appearance: | Colorless to faint pink liquid |
| Specification: |
?Ammonium thioglycolate may be sensitive to heat. Ammonium thioglycolate is incompatible with acids. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Clear, colorless liquid Water-white liquid |
| Usage: | Used in treatments to ‘perm’ hair. |
| Safety Data | |
 |
|
