| Identification |
| Name: | Propanamide,2-hydroxy-N-(2-hydroxyethyl)- |
| Synonyms: | Lactamide,N-(2-hydroxyethyl)- (6CI,7CI,8CI);Incromectant LMEA;Lactamide MEA;Lacticacid monoethanolamide;Lipamide LMEA;N-(2-Hydroxyethyl)lactamide;N-(b-Hydroxyethyl)-2-hydroxypropionamide;N-(b-Hydroxyethyl)lactamide;NSC11062; |
| CAS: | 5422-34-4 |
| EINECS: | 226-546-1 |
| Molecular Formula: | C5H11NO3 |
| Molecular Weight: | 133.1457 |
| InChI: | InChI=1/C5H11NO3/c1-4(8)5(9)6-2-3-7/h4,7-8H,2-3H2,1H3,(H,6,9) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.184 g/cm3 |
| Refractive index: | 1.478 |
| Water Solubility: | Very soluble in water; insoluble in pentane and diethyl ether |
| Solubility: | Very soluble in water; insoluble in pentane and diethyl ether |
| Appearance: | Viscous, brownish liquid; Cooked brown roasted aroma |
| Safety Data |
| |
 |
