| Identification | |
| Name: | 1-Butanol, 3-methyl-, carbamate (9CI) |
| Synonyms: | Carbamate (isoamyl);Isoamyl aminoformate;Isoamyl carbamate;Isopentyl carbamate |
| CAS: | 543-86-2 |
| Molecular Formula: | C6H13NO2 |
| Molecular Weight: | 131.17292 |
| InChI: | InChI=1/C6H13NO2/c1-5(2)3-4-9-6(7)8/h5H,3-4H2,1-2H3,(H2,7,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.97 g/cm3 |
| Refractive index: | 1.432 |
| Specification: |
Isoamyl carbamate with cas registry number of 543-86-2 is known as 4-03-00-00058 (Beilstein Handbook Reference) ; Carbamate (isoamyl) ; Isoamyl aminoformate ; Isopentyl carbamate ; 1-Butanol, 3-methyl-, carbamate (9CI) ; Carbamic acid, isopentyl ester . |
| Safety Data | |
 |
|
