| Identification | |
| Name: | Hexyl mandelate |
| Synonyms: | Benzeneacetic acid, .alpha.-hydroxy-, hexyl ester;benzeneacetic acid, alpha-hydroxy-, hexyl ester;Benzeneacetic acid, alpha-hydroxy-, hexyl ester (9CI);Hexyl hydroxy(phenyl)acetate |
| CAS: | 5431-31-2 |
| Molecular Formula: | C14H20O3 |
| Molecular Weight: | 236.3068 |
| InChI: | InChI=1/C14H20O3/c1-2-3-4-8-11-17-14(16)13(15)12-9-6-5-7-10-12/h5-7,9-10,13,15H,2-4,8,11H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 138.2°C |
| Boiling Point: | 344.6°C at 760 mmHg |
| Density: | 1.059g/cm3 |
| Refractive index: | 1.511 |
| Specification: |
Hexyl mandelate with cas registry number of 5431-31-2 is also called for 4-10-00-00571 (Beilstein Handbook Reference) ; AI 3-4202 ; AI3-04202 ; Benzeneacetic acid, alpha-hydroxy-, hexyl ester (9CI) ; Hexylester kyseliny mandlove ; Hexylester kyseliny mandlove [Czech] ; Mandelic acid, hexyl ester . |
| Flash Point: | 138.2°C |
| Safety Data | |
 |
|
