| Identification | |
| Name: | Nonanoic acid, 2-amino- |
| CAS: | 5440-35-7 |
| Molecular Formula: | C9H19 N O2 |
| Molecular Weight: | 173.2527 |
| InChI: | InChI=1/C9H19NO2/c1-2-3-4-5-6-7-8(10)9(11)12/h8H,2-7,10H2,1H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | ~280 °C (dec.) |
| Density: | 0.985 g/cm3 |
| Refractive index: | 1.467 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
 |
|
