| Identification |
| Name: | Cyclohexanone, 4-ethyl- |
| Synonyms: | NSC 21120; |
| CAS: | 5441-51-0 |
| EINECS: | 226-629-2 |
| Molecular Formula: | C8H14O |
| Molecular Weight: | 126.2 |
| InChI: | InChI=1/C8H14O/c1-2-7-3-5-8(9)6-4-7/h7H,2-6H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.916 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.451-1.453 |
| Solubility: | Slightly soluble |
| Appearance: | Clear slightly yellow liquid |
| HS Code: | 29142900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
