| Identification | |
| Name: | Benzoic acid,2-ethylhexyl ester |
| Synonyms: | 1-Hexanol,2-ethyl-, benzoate (6CI); 2-Ethyl-1-hexanol benzoate; 2-Ethylhexyl benzoate;Ethylhexyl benzoate; Finsolv EB; Hi-Ester B 508; NSC 19155; Velate 368 |
| CAS: | 5444-75-7 |
| EINECS: | 226-641-8 |
| Molecular Formula: | C15H22 O2 |
| Molecular Weight: | 234.33398 |
| InChI: | InChI=1S/C15H22O2/c1-3-5-9-13(4-2)12-17-15(16)14-10-7-6-8-11-14/h6-8,10-11,13H,3-5,9,12H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | Boiling point: |
| Flash Point: | 132°C |
| Boiling Point: | 313.1°Cat760mmHg |
| Density: | 0.963g/cm3 |
| Stability: | Incompatible with strong oxidizing agents. Combustible. |
| Refractive index: | 1.49 |
| Water Solubility: | Stability Incompatible with strong oxidizing agents. Combustible. Toxicology No toxicological data available. Toxicity data (The meaning of any toxicological ab |
| Solubility: |
|
| Flash Point: | 132°C |
| Safety Data | |
 |
|
