| Identification |
| Name: | Butanoic acid, 3-oxo-,2-[methyl(phenylmethyl)amino]ethyl ester |
| Synonyms: | 2-(Benzylmethylamino)ethylacetoacetate |
| CAS: | 54527-65-0 |
| EINECS: | 259-197-9 |
| Molecular Formula: | C14H19 N O3 |
| Molecular Weight: | 249.30556 |
| InChI: | InChI=1/C14H19NO3/c1-12(16)11-14(17)18-10-9-15-8-7-13-5-3-2-4-6-13/h2-6,15H,7-11H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 165.815 °C |
| Boiling Point: | 350.563 °C at 760 mmHg |
| Density: | 1.088 g/cm3 |
| Refractive index: | 1.515 |
| Flash Point: | 165.815 °C |
| Usage: | Intermediate for the syntheses of different organic chemicals. Attributes Contact us for further information Contact |
| Safety Data |
| |
 |
