| Identification | |
| Name: | Methyl 5-bromovalerate |
| Synonyms: | Valericacid, 5-bromo-, methyl ester (7CI,8CI);5-Bromopentanoic acid methyl ester;5-Bromovaleric acid methyl ester;Methyl 5-bromopentanoate;Methyl5-bromovalerate;Methyl d-bromovalerate;Methyl w-bromopentanoate;NSC 23228; |
| CAS: | 5454-83-1 |
| EINECS: | 226-709-7 |
| Molecular Formula: | C6H11BrO2 |
| Molecular Weight: | 195.05 |
| InChI: | InChI=1/C6H11BrO2/c1-9-6(8)4-2-3-5-7/h2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.363 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.462-1.464 |
| Appearance: | Clear pink to brown liquid. |
| Specification: |
Methyl 5-bromovalerate , its CAS NO. is 5454-83-1, the synonyms are Methyl omega-bromopentanoate ; Pentanoic acid, 5-bromo-, methyl ester ; Valeric acid, 5-bromo-, methyl ester (8CI) . |
| HS Code: | 29159080 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
