| Identification | |
| Name: | Acetomenadione |
| Synonyms: | acetohydroxamic acid |
| CAS: | 546-88-3 |
| EINECS: | 208-913-8 |
| Molecular Formula: | C2H5NO2 |
| Molecular Weight: | 75.07 |
| InChI: | InChI=1/C2H5NO2/c1-2(4)3-5/h5H,1H3,(H,3,4) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.155g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.42 |
| Solubility: | Very soluble |
| Appearance: | White Crystalline Solid |
| Specification: |
Acetohydroxamic Acid , with CAS number of 546-88-3, can be called Acetamide, N-hydroxy- ; Acetic acid, oxime ; Acethydroxamsaeure ; Acide acetohydroxamique ; Acidum acetohydroxamicum ; Hydroxylamine, N-acetyl- ; N-Acetylhydroxylamine ; N-Hydroxyacetamide . It is a white crystalline solid, Acetohydroxamic acid is a drug that is a potent and irreversible inhibitor of bacterial and plant urease. Acetohydroxamic Acid (CAS NO.546-88-3) is used for urinary tract infections. |
| Packinggroup: | II |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Hygroscopic |
| Usage: | A urease inhibitor |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
