| Identification | |
| Name: | Propanoic acid,3-mercapto-, ethyl ester |
| Synonyms: | Propionicacid, 3-mercapto-, ethyl ester (7CI,8CI); 3-Mercaptopropanoic acid ethyl ester;3-Mercaptopropionic acid ethyl ester; EPM; EPM (thiol); Ethyl3-mercaptopropanoate; Ethyl 3-mercaptopropionate; Ethyl b-mercaptopropionate; NSC 25754; b-Mercaptopropionic acid ethylester |
| CAS: | 5466-06-8 |
| EINECS: | 226-771-5 |
| Molecular Formula: | C5H10 O2 S |
| Molecular Weight: | 134.1967 |
| InChI: | InChI=1S/C5H10O2S/c1-2-7-5(6)3-4-8/h8H,2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.03 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. |
| Refractive index: | n20/D 1.457(lit.) |
| Water Solubility: | Stability Stable. Combustible. Incompatible with strong oxidizing agents,strong bases. Toxicology Skin, eye and respiratory irritant. Toxicology notfully investigated. Toxicity |
| Solubility: |
|
| Appearance: | colourless liquid with an unpleasant smell |
| Specification: | colourless liquid with an unpleasant smell Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
