| Identification | |
| Name: | Ethanone,2-amino-1-phenyl-, hydrochloride (1:1) |
| Synonyms: | Acetophenone,2-amino-, hydrochloride (8CI);Ethanone, 2-amino-1-phenyl-, hydrochloride(9CI);2-Amino-1-phenyl-1-ethanone hydrochloride;2-Amino-1-phenylethanonehydrochloride;Phenacylamine hydrochloride;alpha-Aminoacetophenone hydrochloride; |
| CAS: | 5468-37-1 |
| EINECS: | 226-787-2 |
| Molecular Formula: | C8H9NO.HCl |
| Molecular Weight: | 171.62 |
| InChI: | InChI=1/C8H9NO.ClH/c9-6-8(10)7-4-2-1-3-5-7;/h1-5H,6,9H2;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 103.4°C |
| Boiling Point: | 247.3°Cat760mmHg |
| Density: | 1.084g/cm3 |
| Appearance: | off-white crystalline powder |
| Specification: | Off-white crystalline Safety Statements:37/39-26 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 103.4°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
