| Identification | |
| Name: | Methyl 6-methylnicotinate |
| Synonyms: | 3-pyridinecarboxylic acid, 6-methyl-, methyl ester;3-(Methoxycarbonyl)-6-methylpyridine;5-Methoxycarbonyl-2-methylpyridine;6-Methyl-3-pyridinecarboxylic acid methylester;6-Methylnicotinic acid methyl ester;Methyl6-methyl-3-pyridinecarboxylate;Methyl 6-methylaminonicotinate;6-Methyl nicotinic acid methyl ester;methyl 6-methylpyridine-3-carboxylate; |
| CAS: | 5470-70-2 |
| Molecular Formula: | C8H9NO2 |
| Molecular Weight: | 151.16 |
| InChI: | InChI=1/C8H9NO2/c1-6-3-4-7(5-9-6)8(10)11-2/h3-5H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 152 |
| Stability: | N/A |
| Refractive index: | 1.51 |
| Appearance: | Brown Solid |
| Specification: |
? Methyl 6-methylnicotinate , with CAS number of 5470-70-2, can be called 3-pyridinecarboxylic acid, 6-methyl-, methyl ester ; 3-(Methoxycarbonyl)-6-methylpyridine ; 5-Methoxycarbonyl-2-methylpyridine ; 6-Methyl-3-pyridinecarboxylic acid methylester ; 6-Methylnicotinic acid methyl ester ; Methyl6-methyl-3-pyridinecarboxylate ; Methyl 6-methylaminonicotinate ; 6-Methyl nicotinic acid methyl ester . It is a brown solid. |
| Storage Temperature: | Refrigerator |
| Usage: | It is used in the treatment of CNS disorders using D-amino acid oxidase and D-aspartate oxidase inhibitors. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
