| Identification | |
| Name: | 3,3',5,5'-Tetramethylbenzidine |
| CAS: | 54827-17-7 |
| EINECS: | 259-364-6 |
| Molecular Formula: | C16H20N2 |
| Molecular Weight: | 240.35 |
| InChI: | InChI=1/C16H20N2/c1-9-5-13(6-10(2)15(9)17)14-7-11(3)16(18)12(4)8-14/h5-8H,17-18H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2796 8/PG 2 |
| Density: | 1.071 g/cm3 |
| Stability: | Stable, but moisture sensitive and may be light sensitive. Incompatible with water, strong oxidizing agents. |
| Refractive index: | 1.594 |
| Water Solubility: | Slightly soluble. |
| Solubility: | Water solubility: Slightly soluble. |
| Appearance: | White or light yellow solid |
| Specification: |
?3,3',5,5'-Tetramethylbenzidine , its cas register number is 54827-17-7. It also can be called Tetramethylbenzidine ; 3,3',5,5'-Tetramethyl-(1,1'-biphenyl)-4,4'-diamine ; TMB Quick ; and (1,1'-Biphenyl)-4,4'-diamine, 3,3',5,5'-tetramethyl- . |
| Report: |
EPA Genetic Toxicology Program. Reported in EPA TSCA Inventory. |
| HS Code: | 29215990 |
| Sensitive: | Light Sensitive |
| Usage: | Research chemical. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
