| Identification |
| Name: | isonicotinic acid |
| Synonyms: | 4-pyridinecarboxylic acid; pyridine-4-carboxylic acid; PYRIDINE-3-CARBOXYLIC ACID; PYRIDINE-GAMMA-CARBOXYLIC ACID; RARECHEM AL BO 0219; TIMTEC-BB SBB004278; 4-Carboxypyridine; Acide iso-nicotinique; acideiso-nicotinique; 4-Carboxy Pyridine; Isonicotic acid |
| CAS: | 55-22-1 |
| EINECS: | 200-228-2 |
| Molecular Formula: | C6H5NO2 |
| Molecular Weight: | 123.11 |
| InChI: | InChI=1/C6H5NO2/c8-6(9)5-1-3-7-4-2-5/h1-4H,(H,8,9) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Density: | 1.293g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | White to off-white crystalline solid |
| HS Code: | 29333999 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | yellow to tan |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
