| Identification | |
| Name: | Acetamide,2-bromo-N-[4-chloro-2-(2-chlorobenzoyl)phenyl]- |
| Synonyms: | Acetanilide,2-bromo-4'-chloro-2'-(o-chlorobenzoyl)- (7CI,8CI) |
| CAS: | 5504-92-7 |
| EINECS: | 226-844-1 |
| Molecular Formula: | C15H10 Br Cl2 N O2 |
| Molecular Weight: | 387.06 |
| InChI: | InChI=1/C15H10BrCl2NO2/c16-8-14(20)19-13-6-5-9(17)7-11(13)15(21)10-3-1-2-4-12(10)18/h1-7H,8H2,(H,19,20) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 301.3°C |
| Boiling Point: | 574.5°Cat760mmHg |
| Density: | 1.628g/cm3 |
| Refractive index: | 1.66 |
| Specification: | White Crystals usageEng:Used in the synthesis of Cloxazolam and its metabolites. |
| Flash Point: | 301.3°C |
| Usage: | Used in the synthesis of Cloxazolam and its metabolites. |
| Safety Data | |
 |
|
