| Identification | |
| Name: | Benzenepentanol, g-methyl- |
| Synonyms: | 3-Methyl-5-phenyl-1-pentanol;3-Methyl-5-phenylpentanol;5-Phenyl-3-methylpentanol;Mefrosol;Phenoxanol; |
| CAS: | 55066-48-3 |
| EINECS: | 259-461-3 |
| Molecular Formula: | C12H18O |
| Molecular Weight: | 178.2707 |
| InChI: | InChI=1/C12H18O/c1-11(9-10-13)7-8-12-5-3-2-4-6-12/h2-6,11,13H,7-10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.957 g/cm3 |
| Refractive index: | 1.511 |
| Appearance: | colorless clear liquid |
| Specification: |
The 3-Methyl-5-phenylpentan-1-ol, with the CAS registry number 55066-48-3 and EINECS registry number 259-461-3, is also called 3-Methyl-5-phenyl-n-pentanol. And the molecular formula of the chemical is C12H18O. The characteristics of this chemical are as followings: (1)ACD/LogP: 3.15; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.15; (4)ACD/LogD (pH 7.4): 3.15; (5)ACD/BCF (pH 5.5): 144.73; (6)ACD/BCF (pH 7.4): 144.73; (7)ACD/KOC (pH 5.5): 1225.03; (8)ACD/KOC (pH 7.4): 1225.03; (9)#H bond acceptors: 1; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 6; (12)Polar Surface Area: 9.23 Å2; (13)Index of Refraction: 1.511; (14)Molar Refractivity: 55.82 cm3; (15)Molar Volume: 186.1 cm3; (16)Polarizability: 22.13×10-24cm3; (17)Surface Tension: 36.3 dyne/cm; (18)Density: 0.957 g/cm3; (19)Flash Point: 101.8 °C; (20)Enthalpy of Vaporization: 52.58 kJ/mol; (21)Boiling Point: 260 °C at 760 mmHg; (22)Vapour Pressure: 0.00637 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
