| Identification | |
| Name: | Acitretin |
| Synonyms: | 9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethyl-2,4,6,8-nonatetraenoic acid; Neotigason; Soriatane; acitretin |
| CAS: | 55079-83-9 |
| EINECS: | 259-474-4 |
| Molecular Formula: | C21H26O3 |
| Molecular Weight: | 326.43 |
| InChI: | InChI=1/C21H26O3/c1-14(8-7-9-15(2)12-21(22)23)10-11-19-16(3)13-20(24-6)18(5)17(19)4/h7-13H,1-6H3,(H,22,23)/b9-7+,11-10+,14-8+,15-12+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.051 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.569 |
| Solubility: | Insoluble |
| Appearance: | crystalline solid |
| Specification: |
?Acitretin (CAS NO.55079-83-9) is also named as (all-E)-9-(4-Methoxy-2,3,6-trimethylphenyl)-3,7-dimethyl-2,4,6,8-nonatetraenoic acid ; Acitretina ; Acitretina [Spanish] ; Acitretine ; Acitretine [French] ; Acitretinum ; Acitretinum [Latin] ; CCRIS 5534 ; Etretin ; HSDB 7187 ; Neotigason ; Retinoid etretin ; Ro 10-1670 ; Ro 10-1670/000 ; Soriatane ; TMMP ; U0279 ; UNII-LCH760E9T7 ; all-trans-3,7-Dimethyl-9-(4-methoxy-2,3,6-trimethylphenyl)-2,4,6,8-nonatetraenoic acid ; all-trans-Acitretin?.?Acitretin (CAS NO.55079-83-9) is crystalline solid. |
| Packinggroup: | III |
| Color: | Crystals from hexane Yellow to greenish-yellow powder |
| Usage: | A synthetic retinoid which is the major metabolite of etretinate (E938000). |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
