| Identification | |
| Name: | N-Acetoxy-4-fluorenylacetamide |
| Synonyms: | N-Acetyloxy-N-(9H-fluoren-4-yl)acetamide |
| CAS: | 55080-20-1 |
| Molecular Formula: | C17H15NO3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C17H15NO3/c1-11(19)18(21-12(2)20)16-9-5-7-14-10-13-6-3-4-8-15(13)17(14)16/h3-9H,10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 223°C |
| Boiling Point: | 445.1°C at 760 mmHg |
| Density: | 1.279g/cm3 |
| Refractive index: | 1.639 |
| Specification: |
N-Acetoxy-4-fluorenylacetamide (CAS NO.55080-20-1) is also named as Acetic acid, ester with N-(fluoren-4-yl)acetohydroxamic acid ; N-(Fluoren-4-yl)acetohydroxamic acetate ; Acetic acid, (N-acetyl-N-(4-fluorenyl)amino) ester . N-Acetoxy-4-fluorenylacetamide (CAS NO.55080-20-1) is toxic. It is flammable. It will produce toxic nitrogen oxide fumes by heat. So the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 223°C |
| Safety Data | |
 |
|
