| Identification | |
| Name: | L-Chiro-Inositol |
| Synonyms: | Inositol,L-chiro- (8CI);Cyclohexane-1,2,3,4,5,6-hexol; |
| CAS: | 551-72-4 |
| EINECS: | 209-000-7 |
| Molecular Formula: | C6H12O6 |
| Molecular Weight: | 180.16 |
| InChI: | InChI=1/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4-,5+,6+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 2.038 g/cm3 |
| Refractive index: | 1.784 |
| Specification: | White crystalline powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29061390 |
| Storage Temperature: | Freezer |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
