| Identification |
| Name: | 2-Chloro-6-fluorobenzyl chloride |
| Synonyms: | alpha,2-Dichloro-6-fluorotoluene; 2-Chloro-6-Fluorochlorobenzyl; 1-Chloro-2-(chloromethyl)-3-fluorobenzene |
| CAS: | 55117-15-2 |
| EINECS: | 259-487-5 |
| Molecular Formula: | C7H5Cl2F |
| Molecular Weight: | 179.02 |
| InChI: | InChI=1/C7H5Cl2F/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 |
| Density: | 1.401 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.536-1.538 |
| Solubility: | Insoluble |
| Appearance: | clear, colorless |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Store protected from moisture. |
| Sensitive: | Lachrymatory |
| Safety Data |
| Hazard Symbols |
C:Corrosive
N:Dangerousfortheenvironment
|
| |
 |
