| Identification | |
| Name: | 9-bromo-9-phenylfluorene |
| Synonyms: | 9-Bromo-9-phenylfuorene; 9-Bromo-9-phenyl-9H-fluorene; |
| CAS: | 55135-66-5 |
| EINECS: | -0 |
| Molecular Formula: | C19H13Br |
| Molecular Weight: | 321.21 |
| InChI: | InChI=1/C19H13Br/c20-17-12-6-11-16-14-9-4-5-10-15(14)18(19(16)17)13-7-2-1-3-8-13/h1-12,18H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Density: | 1.425 g/cm3 |
| Refractive index: | 1.674 |
| Solubility: | Insoluble |
| Specification: |
9-Bromo-9-phenylfluorene , its CAS NO. is 55135-66-5, the synonyms are 368873_ALDRICH ; NSC28079 ; MolPort-000-883-448 ; AKJ-91526 ; CID231624 . |
| Packinggroup: | II |
| Usage: | A bulky amine protecting reagent reported to be 6000 times more stable to acid than the trityl group |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
