| Identification | |
| Name: | Thieno[3,2-c]pyridine,5-[(2-chlorophenyl)methyl]-4,5,6,7-tetrahydro- |
| Synonyms: | PCR 5332;Ticlid; Ticlopidine; Tiklyd |
| CAS: | 55142-85-3 |
| EINECS: | 259-498-5 |
| Molecular Formula: | C14H14 Cl N S |
| Molecular Weight: | 263.79 |
| InChI: | InChI=1/C14H14ClNS/c15-13-4-2-1-3-11(13)9-16-7-5-14-12(10-16)6-8-17-14/h1-4,6,8H,5,7,9-10H2 |
| Molecular Structure: |  |
| Properties | |
| Specification: |
Ticlopidine , its cas register number is 55142-85-3. It also can be called Ticlopidine [INN:BAN] ; 5-((2-Chlorophenyl)methyl)-4,5,6,7-tetrahydrothieno(3,2-c)pyridine ; Ticlopidina ; Ticlopidinum ; Thieno(3,2-c)pyridine, 4,5,6,7-tetrahydro-5-((2-chlorophenyl)methyl)- ; Thieno(3,2-c)pyridine, 5-((2-chlorophenyl)methyl)-4,5,6,7-tetrahydro- .It is an antiplatelet drug in the thienopyridine family. Also it is an effective inhibitor of platelet aggregation. The drug has been found to significantly reduce infarction size in acute myocardial infarcts and is an effective antithrombotic agent in arteriovenous fistulas, aorto-coronary bypass grafts, ischemic heart disease, venous thrombosis, and arteriosclerosis. |
| Safety Data | |
 |
|
