| Identification | |
| Name: | 4,4'-Bipyridine |
| Synonyms: | 4,4'-dipyridyl; 4,4-Bipyridyl |
| CAS: | 553-26-4 |
| EINECS: | 209-036-3 |
| Molecular Formula: | C10H8N2 |
| Molecular Weight: | 156.19 |
| InChI: | InChI=1/C10H8N2/c1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Flash Point: | 305 C |
| Density: | 1.106g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids. |
| Refractive index: | 1.58 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble AUTOIGNITION |
| Appearance: | white to off-white powder |
| Packinggroup: | III |
| HS Code: | 29333999 |
| Flash Point: | 305 C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Hygroscopic |
| Usage: | Intermediate product. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
