| Identification | |
| Name: | 3-Iodo-2-propynyl butylcarbamate |
| Synonyms: | Carbamicacid, butyl-, 3-iodo-2-propynyl ester (9CI);3-Iodo-2-propynylN-butylcarbamate;3-Iodo-2-propynyl butylcarbamate;3-Iodopropargyln-butylcarbamate;Acticide IPW 50;Biodocarb;Coatcide 123;Dekaben LMB;Ecobois;Fungitrol 720;Fungitrol 820;Fungitrol 920;Glycacil;Glycasil L;Guardsan 388;IBF 8DOP;IPBC;IPBC 40;Iodocarb;MP 100;Mergal 710S;Neomid220;Omacide IPBC;Omacide IPBC 100;Polyphase;Polyphase 641;Polyphase AF 1;Polyphase CST;Polyphase P100;Preventol MP 100;Thompson's Wood Protector;Troysan Polyphase AF 3;Troysan Polyphase P 100;Troysan Polyphase P 20T;Troysan Polyphase WD 17;Yotoru IP; |
| CAS: | 55406-53-6 |
| EINECS: | 259-627-5 |
| Molecular Formula: | C8H12 I N O2 |
| Molecular Weight: | 281.09085 |
| InChI: | InChI=1S/C8H12INO2/c1-2-3-6-10-8(11)12-7-4-5-9/h2-3,6-7H2,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.606 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | 150 (mg/l) |
| Solubility: | 150 (mg/l) |
| Appearance: | white to off-white powder |
| Specification: | Liquid usageEng:Glycacil(R) 2000 is used as a preservative in personal care formulations. |
| Packinggroup: | III |
| Storage Temperature: | Refrigerator |
| Color: | Off-white, dull color powder White, crystalline powder |
| Usage: | Glycacil(R) 2000 is used as a preservative in personal care formulations. |
| Safety Data | |
| Hazard Symbols | |
 |
|
