| Identification | |
| Name: | Phenol,5-[(aminooxy)methyl]-2-bromo- |
| Synonyms: | m-Cresol, a-(aminooxy)-6-bromo- (7CI,8CI);3-Hydroxy-4-bromobenzyloxyamine; 4-Bromo-3-hydroxybenzyloxyamine; Brocresin; Brocresine;CL 54998; NSD 1055; m-Hydroxy-p-bromobenzyloxyamine; a-(Aminooxy)-6-bromo-m-cresol |
| CAS: | 555-65-7 |
| Molecular Formula: | C7H8 Br N O2 |
| Molecular Weight: | 218.07 |
| InChI: | InChI=1/C7H8BrNO2/c8-6-2-1-5(4-11-9)3-7(6)10/h1-3,10H,4,9H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 163.9°C |
| Boiling Point: | 347.3°Cat760mmHg |
| Density: | 1.672g/cm3 |
| Refractive index: | 1.623 |
| Specification: |
Brocresine (CAS NO.555-65-7), an aromatic L-amino acid decarboxylase inhibitor with both a peripheral and central action was shown to potentiate the therapeutic effect of levodopa in Parkinson's disease. The search for useful decarboxylase inhibitors therefore need not be limited to agents that do not pass the blood/brain barrier. |
| Flash Point: | 163.9°C |
| Safety Data | |
 |
|
