| Identification | |
| Name: | 2-Propenoic acid,3-(3-nitrophenyl)- |
| Synonyms: | Cinnamicacid, m-nitro- (6CI,7CI,8CI);3-(3-Nitrophenyl)-2-propenoic acid;3-(3-Nitrophenyl)acrylic acid;3-Nitrobenzenepropenoic acid;Ethyl 3-(3-nitrophenyl)-2-propenoate;NSC 5408;m-Nitrocinnamic acid; |
| CAS: | 555-68-0 |
| EINECS: | 209-104-2 |
| Molecular Formula: | C9H7NO4 |
| Molecular Weight: | 193.16 |
| InChI: | InChI=1/C9H7NO4/c11-9(12)5-4-7-2-1-3-8(6-7)10(13)14/h1-6H,(H,11,12)/b5-4+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.411 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | very slightly yellow solid |
| Specification: | Light yellow fine crystalline powder Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
