| Identification | |
| Name: | 3-Chloropyrazine-2-carbonitrile |
| Synonyms: | Pyrazinecarbonitrile,3-chloro- (7CI,9CI);2-Chloro-3-cyanopyrazine; |
| CAS: | 55557-52-3 |
| Molecular Formula: | C5H2ClN3 |
| Molecular Weight: | 139.5425 |
| InChI: | InChI=1/C5H2ClN3/c6-5-4(3-7)8-1-2-9-5/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Density: | 1.43 g/cm3 |
| Refractive index: | 1.568 |
| Specification: |
2-Chloro-3-cyanopyrazine , its cas register number is 55557-52-3. It also can be called 3-chloropyrazine-2-carbonitrile ; 3-chloro-2-cyanopyrazine ; 3-chloropyrazin-2-carbonitrile ; 3-chloro-2-pyrazinecarbonitrile ; 3-chloropyrazine-2-carbonitrile, 95+% ; 2-chloro-3-cyanopyrazine 95%+ and so on. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
