| Identification |
| Name: | L-Alanine, phenylmethylester, hydrochloride (1:1) |
| Synonyms: | Alaninebenzyl ester hydrochloride (6CI);Alanine, benzyl ester, hydrochloride, L-(7CI,8CI);L-Alanine, phenylmethyl ester, hydrochloride (9CI);(S)-Alaninehydrochloride benzyl ester;(S)-Benzyl 2-aminopropanoate hydrochloride;BenzylL-alaninate hydrochloride;NSC 523831; |
| CAS: | 5557-83-5 |
| EINECS: | 226-920-4 |
| Molecular Formula: | C10H13NO2.HCl |
| Molecular Weight: | 215.68 |
| InChI: | InChI=1/C10H13NO2/c1-8(11)10(12)13-7-9-5-3-2-4-6-9/h2-6,8H,7,11H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 135 to 145 ºC |
| Density: | 1.1g/cm3 |
| Refractive index: | 1.53 |
| Appearance: | White to off white powder |
| Storage Temperature: | −20°C |
| Safety Data |
| |
 |
